C19H20F2N2O — CID 90654724
(4S,5S)-5-(aminomethyl)-1-benzyl-4-(2,5-difluorophenyl)piperidin-2-one (PubChem CID 90654724) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is (4S,5S)-5-(aminomethyl)-1-benzyl-4-(2,5-difluorophenyl)piperidin-2-one.
| Compound Name | (4S,5S)-5-(aminomethyl)-1-benzyl-4-(2,5-difluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 90654724 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (4S,5S)-5-(aminomethyl)-1-benzyl-4-(2,5-difluorophenyl)piperidin-2-one |
| SMILES | NC[C@H]1CN(Cc2ccccc2)C(=O)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H20F2N2O/c20-15-6-7-18(21)17(8-15)16-9-19(24)23(12-14(16)10-22)11-13-4-2-1-3-5-13/h1-8,14,16H,9-12,22H2/t14-,16-/m0/s1 |
| InChIKey | VLMRHZZWZAZTHW-HOCLYGCPSA-N |
| XLogP | 3.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |