C20H20F3N5O — CID 90654736
(4S,5S)-5-(aminomethyl)-1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-2-one (PubChem CID 90654736) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is (4S,5S)-5-(aminomethyl)-1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-2-one.
| Compound Name | (4S,5S)-5-(aminomethyl)-1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 90654736 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (4S,5S)-5-(aminomethyl)-1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-2-one |
| SMILES | Cc1cc2ncc(N3C[C@H](CN)[C@@H](c4cc(F)c(F)cc4F)CC3=O)c(C)n2n1 |
| InChI | InChI=1S/C20H20F3N5O/c1-10-3-19-25-8-18(11(2)28(19)26-10)27-9-12(7-24)13(5-20(27)29)14-4-16(22)17(23)6-15(14)21/h3-4,6,8,12-13H,5,7,9,24H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | KARLWZPXVLEHOU-STQMWFEESA-N |
| XLogP | 2.86 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|