C25H26ClF3N4O7S — CID 90654746
2-chloro-4,4-difluoro-1'-[[1-(3-fluoro-2-pyridinyl)-3-methylpyrazol-4-yl]methyl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid (PubChem CID 90654746) has the molecular formula C25H26ClF3N4O7S and a molecular weight of 619.02 g/mol. Its IUPAC name is 2-chloro-4,4-difluoro-1'-[[1-(3-fluoro-2-pyridinyl)-3-methylpyrazol-4-yl]methyl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid.
| Compound Name | 2-chloro-4,4-difluoro-1'-[[1-(3-fluoro-2-pyridinyl)-3-methylpyrazol-4-yl]methyl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 90654746 |
| Molecular Formula | C25H26ClF3N4O7S |
| Molecular Weight | 619.02 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 2-chloro-4,4-difluoro-1'-[[1-(3-fluoro-2-pyridinyl)-3-methylpyrazol-4-yl]methyl]spiro[5H-thieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid |
| SMILES | Cc1nn(-c2ncccc2F)cc1CN1CCC2(CC1)OCC(F)(F)c1cc(Cl)sc12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C21H20ClF3N4OS.C4H6O6/c1-13-14(11-29(27-13)19-16(23)3-2-6-26-19)10-28-7-4-20(5-8-28)18-15(9-17(22)31-18)21(24,25)12-30-20;5-1(3(7)8)2(6)4(9)10/h2-3,6,9,11H,4-5,7-8,10,12H2,1H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ITMZJOPRUNLERC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.02 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |