C27H33ClN4O8S — CID 90654758
2-chloro-1'-[[1-[3-(methoxymethyl)-2-pyridinyl]-3-methylpyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid (PubChem CID 90654758) has the molecular formula C27H33ClN4O8S and a molecular weight of 609.10 g/mol. Its IUPAC name is 2-chloro-1'-[[1-[3-(methoxymethyl)-2-pyridinyl]-3-methylpyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid.
| Compound Name | 2-chloro-1'-[[1-[3-(methoxymethyl)-2-pyridinyl]-3-methylpyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 90654758 |
| Molecular Formula | C27H33ClN4O8S |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 2-chloro-1'-[[1-[3-(methoxymethyl)-2-pyridinyl]-3-methylpyrazol-4-yl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine];2,3-dihydroxybutanedioic acid |
| SMILES | COCc1cccnc1-n1cc(CN2CCC3(CC2)OCCc2cc(Cl)sc23)c(C)n1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C23H27ClN4O2S.C4H6O6/c1-16-19(14-28(26-16)22-18(15-29-2)4-3-8-25-22)13-27-9-6-23(7-10-27)21-17(5-11-30-23)12-20(24)31-21;5-1(3(7)8)2(6)4(9)10/h3-4,8,12,14H,5-7,9-11,13,15H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | HNOULVHXIBICDV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 167.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |