About 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one
6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 90654826) has the molecular formula C16H12N4O4S
and a molecular weight of 356.36 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 90654826 |
| Molecular Formula | C16H12N4O4S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1ccc(-c2cn(-c3ccc4c(c3)S(=O)(=O)NC4=O)nn2)cc1 |
| InChI | InChI=1S/C16H12N4O4S/c1-24-12-5-2-10(3-6-12)14-9-20(19-17-14)11-4-7-13-15(8-11)25(22,23)18-16(13)21/h2-9H,1H3,(H,18,21) |
| InChIKey | YCRQMZCTGOAPJI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one (CID 90654826) is 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one is COc1ccc(-c2cn(-c3ccc4c(c3)S(=O)(=O)NC4=O)nn2)cc1.
What is the InChIKey of 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is YCRQMZCTGOAPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O4S/c1-24-12-5-2-10(3-6-12)14-9-20(19-17-14)11-4-7-13-15(8-11)25(22,23)18-16(13)21/h2-9H,1H3,(H,18,21).
What are the key properties of 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one?
6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 356.36 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(4-methoxyphenyl)triazol-1-yl]-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 90654826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).