C21H26FN3O2S — CID 90654968
2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(2-methylbutyl)benzimidazole (PubChem CID 90654968) has the molecular formula C21H26FN3O2S and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(2-methylbutyl)benzimidazole.
| Compound Name | 2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(2-methylbutyl)benzimidazole |
|---|---|
| PubChem CID | 90654968 |
| Molecular Formula | C21H26FN3O2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-tert-butyl-5-[(2-fluoro-4-pyridinyl)sulfonyl]-1-(2-methylbutyl)benzimidazole |
| SMILES | CCC(C)Cn1c(C(C)(C)C)nc2cc(S(=O)(=O)c3ccnc(F)c3)ccc21 |
| InChI | InChI=1S/C21H26FN3O2S/c1-6-14(2)13-25-18-8-7-15(11-17(18)24-20(25)21(3,4)5)28(26,27)16-9-10-23-19(22)12-16/h7-12,14H,6,13H2,1-5H3 |
| InChIKey | FDJGWSOCJLZQPS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|