C18H22N2O5S — CID 90654971
1'-(cyclopropylmethyl)-5'-(2-methylaziridin-1-yl)sulfonylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 90654971) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)-5'-(2-methylaziridin-1-yl)sulfonylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-(cyclopropylmethyl)-5'-(2-methylaziridin-1-yl)sulfonylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 90654971 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1'-(cyclopropylmethyl)-5'-(2-methylaziridin-1-yl)sulfonylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CC1CN1S(=O)(=O)c1ccc2c(c1)C1(OCCCO1)C(=O)N2CC1CC1 |
| InChI | InChI=1S/C18H22N2O5S/c1-12-10-20(12)26(22,23)14-5-6-16-15(9-14)18(24-7-2-8-25-18)17(21)19(16)11-13-3-4-13/h5-6,9,12-13H,2-4,7-8,10-11H2,1H3 |
| InChIKey | BOOUZFJYELIOBP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|