C30H32N2O3S — CID 90654976
1'-[4-[1-(benzenesulfonyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 90654976) has the molecular formula C30H32N2O3S and a molecular weight of 500.66 g/mol. Its IUPAC name is 1'-[4-[1-(benzenesulfonyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[4-[1-(benzenesulfonyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 90654976 |
| Molecular Formula | C30H32N2O3S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 1'-[4-[1-(benzenesulfonyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | O=S(=O)(c1ccccc1)n1cc(CCCCN2CCC3(CC2)OCc2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C30H32N2O3S/c33-36(34,26-12-2-1-3-13-26)32-22-24(27-14-5-7-16-29(27)32)10-8-9-19-31-20-17-30(18-21-31)28-15-6-4-11-25(28)23-35-30/h1-7,11-16,22H,8-10,17-21,23H2 |
| InChIKey | AFWOHLSEKLBPFK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|