C22H23NO3 — CID 90654978
(1S,5S,8E)-5-(3-hydroxyphenyl)-8-[(3-hydroxyphenyl)methylidene]-2-methyl-2-azabicyclo[3.3.1]nonan-7-one (PubChem CID 90654978) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (1S,5S,8E)-5-(3-hydroxyphenyl)-8-[(3-hydroxyphenyl)methylidene]-2-methyl-2-azabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1S,5S,8E)-5-(3-hydroxyphenyl)-8-[(3-hydroxyphenyl)methylidene]-2-methyl-2-azabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 90654978 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (1S,5S,8E)-5-(3-hydroxyphenyl)-8-[(3-hydroxyphenyl)methylidene]-2-methyl-2-azabicyclo[3.3.1]nonan-7-one |
| SMILES | CN1CC[C@@]2(c3cccc(O)c3)CC(=O)/C(=C/c3cccc(O)c3)[C@@H]1C2 |
| InChI | InChI=1S/C22H23NO3/c1-23-9-8-22(16-5-3-7-18(25)12-16)13-20(23)19(21(26)14-22)11-15-4-2-6-17(24)10-15/h2-7,10-12,20,24-25H,8-9,13-14H2,1H3/b19-11+/t20-,22-/m0/s1 |
| InChIKey | RJJAAHSNJCZQSF-WNIXFANNSA-N |
| XLogP | 3.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|