C20H18F4N2O3 — CID 90655037
2-[5-fluoro-2-methyl-3-[6-(4,4,4-trifluorobutoxy)-3-pyridinyl]indol-1-yl]acetic acid (PubChem CID 90655037) has the molecular formula C20H18F4N2O3 and a molecular weight of 410.37 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[6-(4,4,4-trifluorobutoxy)-3-pyridinyl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[6-(4,4,4-trifluorobutoxy)-3-pyridinyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 90655037 |
| Molecular Formula | C20H18F4N2O3 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[6-(4,4,4-trifluorobutoxy)-3-pyridinyl]indol-1-yl]acetic acid |
| SMILES | Cc1c(-c2ccc(OCCCC(F)(F)F)nc2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C20H18F4N2O3/c1-12-19(15-9-14(21)4-5-16(15)26(12)11-18(27)28)13-3-6-17(25-10-13)29-8-2-7-20(22,23)24/h3-6,9-10H,2,7-8,11H2,1H3,(H,27,28) |
| InChIKey | NYAKGTZHXXIUBN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|