C22H38BN3O5 — CID 90655058
(2S)-2-acetamido-N'-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanediamide (PubChem CID 90655058) has the molecular formula C22H38BN3O5 and a molecular weight of 435.37 g/mol. Its IUPAC name is (2S)-2-acetamido-N'-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanediamide.
| Compound Name | (2S)-2-acetamido-N'-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanediamide |
|---|---|
| PubChem CID | 90655058 |
| Molecular Formula | C22H38BN3O5 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | (2S)-2-acetamido-N'-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanediamide |
| SMILES | CNC(=O)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C22H38BN3O5/c1-12(2)8-18(26-20(29)15(25-13(3)27)11-19(28)24-7)23-30-17-10-14-9-16(21(14,4)5)22(17,6)31-23/h12,14-18H,8-11H2,1-7H3,(H,24,28)(H,25,27)(H,26,29)/t14-,15-,16-,17+,18-,22-/m0/s1 |
| InChIKey | PJAVIPGUMNKCGD-HRVVITOKSA-N |
| XLogP | 1.43 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|