C22H26N2O2S — CID 90655201
4-methyl-2-(10-methylphenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol (PubChem CID 90655201) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-methyl-2-(10-methylphenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol.
| Compound Name | 4-methyl-2-(10-methylphenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol |
|---|---|
| PubChem CID | 90655201 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-methyl-2-(10-methylphenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol |
| SMILES | CN1c2ccccc2Sc2ccc(C3(O)CN(C)C4CCCCC4O3)cc21 |
| InChI | InChI=1S/C22H26N2O2S/c1-23-14-22(25,26-19-9-5-3-7-16(19)23)15-11-12-21-18(13-15)24(2)17-8-4-6-10-20(17)27-21/h4,6,8,10-13,16,19,25H,3,5,7,9,14H2,1-2H3 |
| InChIKey | AKAZQQQRHQNSNR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|