C22H33NO5 — CID 90655424
(1R,4S,10S,11S,12R,15R,16S)-11-ethyl-15-hydroxy-15-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]-13-oxa-5-azatetracyclo[8.6.0.01,5.012,16]hexadecan-14-one (PubChem CID 90655424) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1R,4S,10S,11S,12R,15R,16S)-11-ethyl-15-hydroxy-15-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]-13-oxa-5-azatetracyclo[8.6.0.01,5.012,16]hexadecan-14-one.
| Compound Name | (1R,4S,10S,11S,12R,15R,16S)-11-ethyl-15-hydroxy-15-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]-13-oxa-5-azatetracyclo[8.6.0.01,5.012,16]hexadecan-14-one |
|---|---|
| PubChem CID | 90655424 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (1R,4S,10S,11S,12R,15R,16S)-11-ethyl-15-hydroxy-15-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]-13-oxa-5-azatetracyclo[8.6.0.01,5.012,16]hexadecan-14-one |
| SMILES | CC[C@@H]1[C@H]2OC(=O)[C@](C)(O)[C@H]2[C@]23CC[C@@H]([C@@H]4C[C@@H](C)C(=O)O4)N2CCCC[C@@H]13 |
| InChI | InChI=1S/C22H33NO5/c1-4-13-14-7-5-6-10-23-15(16-11-12(2)19(24)27-16)8-9-22(14,23)18-17(13)28-20(25)21(18,3)26/h12-18,26H,4-11H2,1-3H3/t12-,13+,14+,15+,16+,17-,18+,21-,22-/m1/s1 |
| InChIKey | SVSUKQDSRBZWNP-ORTICVPISA-N |
| XLogP | 2.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |