C23H37NO5 — CID 90655427
methyl (2S)-3-[(1S,3S,4R,5R,11S)-4-ethyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-2-oxa-10-azatricyclo[8.3.0.01,5]tridecan-3-yl]-2-methylpropanoate (PubChem CID 90655427) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is methyl (2S)-3-[(1S,3S,4R,5R,11S)-4-ethyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-2-oxa-10-azatricyclo[8.3.0.01,5]tridecan-3-yl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[(1S,3S,4R,5R,11S)-4-ethyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-2-oxa-10-azatricyclo[8.3.0.01,5]tridecan-3-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 90655427 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | methyl (2S)-3-[(1S,3S,4R,5R,11S)-4-ethyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-2-oxa-10-azatricyclo[8.3.0.01,5]tridecan-3-yl]-2-methylpropanoate |
| SMILES | CC[C@H]1[C@H](C[C@H](C)C(=O)OC)O[C@]23CC[C@@H]([C@@H]4C[C@H](C)C(=O)O4)N2CCCC[C@H]13 |
| InChI | InChI=1S/C23H37NO5/c1-5-16-17-8-6-7-11-24-18(20-13-15(3)22(26)28-20)9-10-23(17,24)29-19(16)12-14(2)21(25)27-4/h14-20H,5-13H2,1-4H3/t14-,15-,16+,17+,18-,19-,20-,23-/m0/s1 |
| InChIKey | KSRHASDCOAHRSY-DTXAHMJKSA-N |
| XLogP | 3.52 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |