C15H15N5O — CID 90655548
(2S)-1-[2-(4-phenyltriazol-1-yl)acetyl]pyrrolidine-2-carbonitrile (PubChem CID 90655548) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is (2S)-1-[2-(4-phenyltriazol-1-yl)acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-(4-phenyltriazol-1-yl)acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 90655548 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2S)-1-[2-(4-phenyltriazol-1-yl)acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)Cn1cc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C15H15N5O/c16-9-13-7-4-8-20(13)15(21)11-19-10-14(17-18-19)12-5-2-1-3-6-12/h1-3,5-6,10,13H,4,7-8,11H2/t13-/m0/s1 |
| InChIKey | CXRDIYCIXJOTBY-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |