C28H49N6O5+ — CID 90655622
[(5S)-6-[[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]amino]-5-[[(2S)-2-[[(2S)-2-(benzylamino)propanoyl]amino]-4-methylpentanoyl]amino]-6-oxohexyl]-trimethylazanium (PubChem CID 90655622) has the molecular formula C28H49N6O5+ and a molecular weight of 549.74 g/mol. Its IUPAC name is [(5S)-6-[[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]amino]-5-[[(2S)-2-[[(2S)-2-(benzylamino)propanoyl]amino]-4-methylpentanoyl]amino]-6-oxohexyl]-trimethylazanium.
| Compound Name | [(5S)-6-[[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]amino]-5-[[(2S)-2-[[(2S)-2-(benzylamino)propanoyl]amino]-4-methylpentanoyl]amino]-6-oxohexyl]-trimethylazanium |
|---|---|
| PubChem CID | 90655622 |
| Molecular Formula | C28H49N6O5+ |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.38 |
| IUPAC Name | [(5S)-6-[[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]amino]-5-[[(2S)-2-[[(2S)-2-(benzylamino)propanoyl]amino]-4-methylpentanoyl]amino]-6-oxohexyl]-trimethylazanium |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)NCc1ccccc1)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)N[C@@H](CO)C(N)=O |
| InChI | InChI=1S/C28H48N6O5/c1-19(2)16-23(32-26(37)20(3)30-17-21-12-8-7-9-13-21)28(39)31-22(14-10-11-15-34(4,5)6)27(38)33-24(18-35)25(29)36/h7-9,12-13,19-20,22-24,30,35H,10-11,14-18H2,1-6H3,(H4-,29,31,32,33,36,37,38,39)/p+1/t20-,22-,23-,24-/m0/s1 |
| InChIKey | FIJMGIYSTZOPHI-BIHRQFPBSA-O |
| XLogP | 0.02 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|