About 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide
3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide (PubChem CID 90655748) has the molecular formula C18H16N4
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide.
Molecular Properties
| Compound Name | 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide |
| PubChem CID | 90655748 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(/C(N)=N/c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C18H16N4/c19-17(20)13-7-3-8-14(11-13)18(21)22-16-10-4-6-12-5-1-2-9-15(12)16/h1-11H,(H3,19,20)(H2,21,22) |
| InChIKey | IHNNMQCDBCUENA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide?
The IUPAC name of 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide (CID 90655748) is 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide.
What is the SMILES notation for 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide?
The canonical SMILES for 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide is [H]/N=C(\N)c1cccc(/C(N)=N/c2cccc3ccccc23)c1.
What is the InChIKey of 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide?
The InChIKey is IHNNMQCDBCUENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4/c19-17(20)13-7-3-8-14(11-13)18(21)22-16-10-4-6-12-5-1-2-9-15(12)16/h1-11H,(H3,19,20)(H2,21,22).
What are the key properties of 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide?
3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide has a molecular weight of 288.35 g/mol, XLogP of 3.16, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N'-naphthalen-1-ylbenzene-1,3-dicarboximidamide is sourced from PubChem (CID 90655748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).