About 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea
1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 90655764) has the molecular formula C16H14N4OS
and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea |
| PubChem CID | 90655764 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | C=CCNC(=O)Nc1nc2cc(-c3cccnc3)ccc2s1 |
| InChI | InChI=1S/C16H14N4OS/c1-2-7-18-15(21)20-16-19-13-9-11(5-6-14(13)22-16)12-4-3-8-17-10-12/h2-6,8-10H,1,7H2,(H2,18,19,20,21) |
| InChIKey | YJBJIZCSDYHEGH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea?
The IUPAC name of 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea (CID 90655764) is 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea.
What is the SMILES notation for 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea?
The canonical SMILES for 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea is C=CCNC(=O)Nc1nc2cc(-c3cccnc3)ccc2s1.
What is the InChIKey of 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea?
The InChIKey is YJBJIZCSDYHEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4OS/c1-2-7-18-15(21)20-16-19-13-9-11(5-6-14(13)22-16)12-4-3-8-17-10-12/h2-6,8-10H,1,7H2,(H2,18,19,20,21).
What are the key properties of 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea?
1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea has a molecular weight of 310.38 g/mol, XLogP of 3.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea is sourced from PubChem (CID 90655764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).