C23H24N2O2 — CID 90655807
2-[2-[4-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 90655807) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[2-[4-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90655807 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[2-[4-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)cc(C2=CCN(CCN3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-16-13-17(2)15-19(14-16)18-7-9-24(10-8-18)11-12-25-22(26)20-5-3-4-6-21(20)23(25)27/h3-7,13-15H,8-12H2,1-2H3 |
| InChIKey | PMNJGGVAOGYYGJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|