About 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine
4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine (PubChem CID 90655987) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine |
| PubChem CID | 90655987 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1onc(N)c1-c1cccc(N)c1 |
| InChI | InChI=1S/C10H11N3O/c1-6-9(10(12)13-14-6)7-3-2-4-8(11)5-7/h2-5H,11H2,1H3,(H2,12,13) |
| InChIKey | QZXFEESTZUEYRD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine?
The IUPAC name of 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine (CID 90655987) is 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine.
What is the SMILES notation for 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine?
The canonical SMILES for 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine is Cc1onc(N)c1-c1cccc(N)c1.
What is the InChIKey of 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine?
The InChIKey is QZXFEESTZUEYRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-6-9(10(12)13-14-6)7-3-2-4-8(11)5-7/h2-5H,11H2,1H3,(H2,12,13).
What are the key properties of 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine?
4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine has a molecular weight of 189.22 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminophenyl)-5-methyl-1,2-oxazol-3-amine is sourced from PubChem (CID 90655987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).