About [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone
[4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone (PubChem CID 90656073) has the molecular formula C24H24N6O2
and a molecular weight of 428.50 g/mol. Its IUPAC name is [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone |
| PubChem CID | 90656073 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cccc(-c2nc(Nc3ccc(C(=O)N4CCOCC4)cc3)c3[nH]cnc3n2)c1C |
| InChI | InChI=1S/C24H24N6O2/c1-15-4-3-5-19(16(15)2)21-28-22-20(25-14-26-22)23(29-21)27-18-8-6-17(7-9-18)24(31)30-10-12-32-13-11-30/h3-9,14H,10-13H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | PCQHZIRDQUSESK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone?
The IUPAC name of [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone (CID 90656073) is [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone?
The canonical SMILES for [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone is Cc1cccc(-c2nc(Nc3ccc(C(=O)N4CCOCC4)cc3)c3[nH]cnc3n2)c1C.
What is the InChIKey of [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone?
The InChIKey is PCQHZIRDQUSESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N6O2/c1-15-4-3-5-19(16(15)2)21-28-22-20(25-14-26-22)23(29-21)27-18-8-6-17(7-9-18)24(31)30-10-12-32-13-11-30/h3-9,14H,10-13H2,1-2H3,(H2,25,26,27,28,29).
What are the key properties of [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone?
[4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone has a molecular weight of 428.50 g/mol, XLogP of 3.85, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[2-(2,3-dimethylphenyl)-7H-purin-6-yl]amino]phenyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 90656073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).