About [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone
[(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone (PubChem CID 90656103) has the molecular formula C24H18N2O4
and a molecular weight of 398.42 g/mol. Its IUPAC name is [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone.
Molecular Properties
| Compound Name | [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone |
| PubChem CID | 90656103 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ncc(-c2ccccn2)o1)[C@H]1COc2cc(Oc3ccccc3)ccc2C1 |
| InChI | InChI=1S/C24H18N2O4/c27-23(24-26-14-22(30-24)20-8-4-5-11-25-20)17-12-16-9-10-19(13-21(16)28-15-17)29-18-6-2-1-3-7-18/h1-11,13-14,17H,12,15H2/t17-/m1/s1 |
| InChIKey | KTRKLISDHZZCIZ-QGZVFWFLSA-N |
| XLogP | 4.96 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The IUPAC name of [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone (CID 90656103) is [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone.
What is the SMILES notation for [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The canonical SMILES for [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone is O=C(c1ncc(-c2ccccn2)o1)[C@H]1COc2cc(Oc3ccccc3)ccc2C1.
What is the InChIKey of [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The InChIKey is KTRKLISDHZZCIZ-QGZVFWFLSA-N. The full InChI is InChI=1S/C24H18N2O4/c27-23(24-26-14-22(30-24)20-8-4-5-11-25-20)17-12-16-9-10-19(13-21(16)28-15-17)29-18-6-2-1-3-7-18/h1-11,13-14,17H,12,15H2/t17-/m1/s1.
What are the key properties of [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
[(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone has a molecular weight of 398.42 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-7-phenoxy-3,4-dihydro-2H-chromen-3-yl]-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone is sourced from PubChem (CID 90656103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).