C39H56N4O3 — CID 90656119
2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione (PubChem CID 90656119) has the molecular formula C39H56N4O3 and a molecular weight of 628.90 g/mol. Its IUPAC name is 2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione.
| Compound Name | 2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 90656119 |
| Molecular Formula | C39H56N4O3 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.44 |
| IUPAC Name | 2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione |
| SMILES | CN(C)c1ccc2c(c1)C(=O)N(CCCCCCOc1cccc3c1CCCC3CCCN1CCN(C3CCCCC3)CC1)C2=O |
| InChI | InChI=1S/C39H56N4O3/c1-40(2)32-20-21-35-36(29-32)39(45)43(38(35)44)23-8-3-4-9-28-46-37-19-11-17-33-30(13-10-18-34(33)37)14-12-22-41-24-26-42(27-25-41)31-15-6-5-7-16-31/h11,17,19-21,29-31H,3-10,12-16,18,22-28H2,1-2H3 |
| InChIKey | HHJGRBDKYZTYNV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|