C16H17Cl2NO3 — CID 9065612
[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065612) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065612 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
| SMILES | C[C@H](OC(=O)C[C@@H]1C=CCC1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NO3/c1-10(22-15(20)8-11-4-2-3-5-11)16(21)19-14-7-6-12(17)9-13(14)18/h2,4,6-7,9-11H,3,5,8H2,1H3,(H,19,21)/t10-,11+/m0/s1 |
| InChIKey | GSFANLWEOVRFTP-WDEREUQCSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|