About [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride
[3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride (PubChem CID 90656346) has the molecular formula C15H24ClN3O2
and a molecular weight of 313.83 g/mol. Its IUPAC name is [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride |
| PubChem CID | 90656346 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride |
| SMILES | CCN(C)C(=O)Oc1cccc2c1C(CCCN)CN2.Cl |
| InChI | InChI=1S/C15H23N3O2.ClH/c1-3-18(2)15(19)20-13-8-4-7-12-14(13)11(10-17-12)6-5-9-16;/h4,7-8,11,17H,3,5-6,9-10,16H2,1-2H3;1H |
| InChIKey | IXBWENUTJICSJU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The IUPAC name of [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride (CID 90656346) is [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride.
What is the SMILES notation for [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The canonical SMILES for [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride is CCN(C)C(=O)Oc1cccc2c1C(CCCN)CN2.Cl.
What is the InChIKey of [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The InChIKey is IXBWENUTJICSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2.ClH/c1-3-18(2)15(19)20-13-8-4-7-12-14(13)11(10-17-12)6-5-9-16;/h4,7-8,11,17H,3,5-6,9-10,16H2,1-2H3;1H.
What are the key properties of [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
[3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride has a molecular weight of 313.83 g/mol, XLogP of 2.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-aminopropyl)-2,3-dihydro-1H-indol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride is sourced from PubChem (CID 90656346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).