About [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride
[1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride (PubChem CID 90656348) has the molecular formula C17H28ClN3O2
and a molecular weight of 341.88 g/mol. Its IUPAC name is [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride |
| PubChem CID | 90656348 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride |
| SMILES | CCN(C)C(=O)Oc1cccc2c1CCN2CCCN(C)C.Cl |
| InChI | InChI=1S/C17H27N3O2.ClH/c1-5-19(4)17(21)22-16-9-6-8-15-14(16)10-13-20(15)12-7-11-18(2)3;/h6,8-9H,5,7,10-13H2,1-4H3;1H |
| InChIKey | GGBOCVUXKXADAF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The IUPAC name of [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride (CID 90656348) is [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride.
What is the SMILES notation for [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The canonical SMILES for [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride is CCN(C)C(=O)Oc1cccc2c1CCN2CCCN(C)C.Cl.
What is the InChIKey of [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
The InChIKey is GGBOCVUXKXADAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O2.ClH/c1-5-19(4)17(21)22-16-9-6-8-15-14(16)10-13-20(15)12-7-11-18(2)3;/h6,8-9H,5,7,10-13H2,1-4H3;1H.
What are the key properties of [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride?
[1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride has a molecular weight of 341.88 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(dimethylamino)propyl]-2,3-dihydroindol-4-yl] N-ethyl-N-methylcarbamate;hydrochloride is sourced from PubChem (CID 90656348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).