C15H19ClN2O4S — CID 90656462
4-[[(2-hydroxy-5-methoxyphenyl)methylamino]methyl]benzenesulfonamide;hydrochloride (PubChem CID 90656462) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is 4-[[(2-hydroxy-5-methoxyphenyl)methylamino]methyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[[(2-hydroxy-5-methoxyphenyl)methylamino]methyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 90656462 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[[(2-hydroxy-5-methoxyphenyl)methylamino]methyl]benzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(O)c(CNCc2ccc(S(N)(=O)=O)cc2)c1.Cl |
| InChI | InChI=1S/C15H18N2O4S.ClH/c1-21-13-4-7-15(18)12(8-13)10-17-9-11-2-5-14(6-3-11)22(16,19)20;/h2-8,17-18H,9-10H2,1H3,(H2,16,19,20);1H |
| InChIKey | WWOIWWYNYYMRJV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|