About 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide
2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide (PubChem CID 90656549) has the molecular formula C14H13ClFIN4O3
and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide |
| PubChem CID | 90656549 |
| Molecular Formula | C14H13ClFIN4O3 |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NC[C@H](O)CO)c1nc(Cl)ncc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H13ClFIN4O3/c15-14-19-5-11(20-10-2-1-7(17)3-9(10)16)12(21-14)13(24)18-4-8(23)6-22/h1-3,5,8,20,22-23H,4,6H2,(H,18,24)/t8-/m0/s1 |
| InChIKey | CDGIQRUGHAEJFI-QMMMGPOBSA-N |
| XLogP | 1.70 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide?
The IUPAC name of 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide (CID 90656549) is 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide.
What is the SMILES notation for 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide?
The canonical SMILES for 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide is O=C(NC[C@H](O)CO)c1nc(Cl)ncc1Nc1ccc(I)cc1F.
What is the InChIKey of 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide?
The InChIKey is CDGIQRUGHAEJFI-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H13ClFIN4O3/c15-14-19-5-11(20-10-2-1-7(17)3-9(10)16)12(21-14)13(24)18-4-8(23)6-22/h1-3,5,8,20,22-23H,4,6H2,(H,18,24)/t8-/m0/s1.
What are the key properties of 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide?
2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide has a molecular weight of 466.64 g/mol, XLogP of 1.70, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(2S)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)pyrimidine-4-carboxamide is sourced from PubChem (CID 90656549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).