About 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol
1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol (PubChem CID 90656800) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol.
Molecular Properties
| Compound Name | 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol |
| PubChem CID | 90656800 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol |
| SMILES | COc1cc2ccc(C(O)(c3ccncc3)C(C)C)cc2cc1OC |
| InChI | InChI=1S/C21H23NO3/c1-14(2)21(23,17-7-9-22-10-8-17)18-6-5-15-12-19(24-3)20(25-4)13-16(15)11-18/h5-14,23H,1-4H3 |
| InChIKey | WLSFHVCGANYCRC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol?
The IUPAC name of 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol (CID 90656800) is 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol.
What is the SMILES notation for 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol?
The canonical SMILES for 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol is COc1cc2ccc(C(O)(c3ccncc3)C(C)C)cc2cc1OC.
What is the InChIKey of 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol?
The InChIKey is WLSFHVCGANYCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c1-14(2)21(23,17-7-9-22-10-8-17)18-6-5-15-12-19(24-3)20(25-4)13-16(15)11-18/h5-14,23H,1-4H3.
What are the key properties of 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol?
1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol has a molecular weight of 337.42 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dimethoxynaphthalen-2-yl)-2-methyl-1-pyridin-4-ylpropan-1-ol is sourced from PubChem (CID 90656800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).