C17H17N3O4 — CID 9065734
[2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065734) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065734 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C=CCC1)Nc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H17N3O4/c21-14(11-23-15(22)10-12-6-4-5-7-12)18-17-20-19-16(24-17)13-8-2-1-3-9-13/h1-4,6,8-9,12H,5,7,10-11H2,(H,18,20,21)/t12-/m0/s1 |
| InChIKey | OFAQSOPEARUDBS-LBPRGKRZSA-N |
| XLogP | 2.57 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|