C17H28N3O12P2- — CID 90657344
[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl] [(2R,5S,6R)-6-methyl-5-(methylazaniumyl)oxan-2-yl] phosphate (PubChem CID 90657344) has the molecular formula C17H28N3O12P2- and a molecular weight of 528.37 g/mol. Its IUPAC name is [[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl] [(2R,5S,6R)-6-methyl-5-(methylazaniumyl)oxan-2-yl] phosphate.
| Compound Name | [[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl] [(2R,5S,6R)-6-methyl-5-(methylazaniumyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 90657344 |
| Molecular Formula | C17H28N3O12P2- |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | [[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphoryl] [(2R,5S,6R)-6-methyl-5-(methylazaniumyl)oxan-2-yl] phosphate |
| SMILES | C[NH2+][C@H]1CC[C@@H](OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O)O[C@@H]1C |
| InChI | InChI=1S/C17H29N3O12P2/c1-9-7-20(17(23)19-16(9)22)14-6-12(21)13(30-14)8-28-33(24,25)32-34(26,27)31-15-5-4-11(18-3)10(2)29-15/h7,10-15,18,21H,4-6,8H2,1-3H3,(H,24,25)(H,26,27)(H,19,22,23)/p-1/t10-,11+,12+,13-,14-,15-/m1/s1 |
| InChIKey | JRJYBKLGPOKTLS-YXJLRHLOSA-M |
| XLogP | -2.43 |
| TPSA | 218.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|