C12H23O14P — CID 90657367
[(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] dihydrogen phosphate (PubChem CID 90657367) has the molecular formula C12H23O14P and a molecular weight of 422.28 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90657367 |
| Molecular Formula | C12H23O14P |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1[C@H](O)[C@H](O)C(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-2-3(14)4(15)9(20)12(24-2)25-10-5(16)7(18)11(8(19)6(10)17)26-27(21,22)23/h2-20H,1H2,(H2,21,22,23)/t2-,3-,4+,5-,6+,7-,8-,9+,10?,11?,12-/m1/s1 |
| InChIKey | RKBZSOHCWNFBLV-KKMCCESSSA-N |
| XLogP | -5.89 |
| TPSA | 247.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|