C6H8O6 — CID 90657650
cis-(4R,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-dione (PubChem CID 90657650) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is cis-(4R,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-dione.
| Compound Name | cis-(4R,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90657650 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | cis-(4R,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-dione |
| SMILES | O=C1C(O)C(=O)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-3,6-9,12H/t1?,2-,3+,6? |
| InChIKey | XQCGHIBXRBNZFL-GCJFSFLGSA-N |
| XLogP | -3.42 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|