C7H11O7- — CID 90657758
(2S,3S,4R,5R,6R)-4,5,6-trihydroxy-3-methoxyoxane-2-carboxylate (PubChem CID 90657758) has the molecular formula C7H11O7- and a molecular weight of 207.16 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-4,5,6-trihydroxy-3-methoxyoxane-2-carboxylate.
| Compound Name | (2S,3S,4R,5R,6R)-4,5,6-trihydroxy-3-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 90657758 |
| Molecular Formula | C7H11O7- |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (2S,3S,4R,5R,6R)-4,5,6-trihydroxy-3-methoxyoxane-2-carboxylate |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)[C@H](O)O[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C7H12O7/c1-13-4-2(8)3(9)7(12)14-5(4)6(10)11/h2-5,7-9,12H,1H3,(H,10,11)/p-1/t2-,3-,4+,5+,7-/m1/s1 |
| InChIKey | WGLLPAPKWFDHHV-RLZVPWTLSA-M |
| XLogP | -3.81 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |