C20H32O — CID 90657801
[(1R,2S,6S,7R,10S,12S)-2,6-dimethyl-13-methylidene-6-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]methanol (PubChem CID 90657801) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is [(1R,2S,6S,7R,10S,12S)-2,6-dimethyl-13-methylidene-6-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]methanol.
| Compound Name | [(1R,2S,6S,7R,10S,12S)-2,6-dimethyl-13-methylidene-6-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]methanol |
|---|---|
| PubChem CID | 90657801 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | [(1R,2S,6S,7R,10S,12S)-2,6-dimethyl-13-methylidene-6-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]methanol |
| SMILES | C=C1CC[C@@]23C[C@@H]1C[C@@H]2CC[C@H]1[C@@](C)(CO)CCC[C@@]13C |
| InChI | InChI=1S/C20H32O/c1-14-7-10-20-12-15(14)11-16(20)5-6-17-18(2,13-21)8-4-9-19(17,20)3/h15-17,21H,1,4-13H2,2-3H3/t15-,16-,17-,18+,19-,20+/m0/s1 |
| InChIKey | MKQDLCAKPDXHKE-YDRVBMSGSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|