About 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine
5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine (PubChem CID 90658036) has the molecular formula C10H17N2+
and a molecular weight of 165.26 g/mol. Its IUPAC name is 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine |
| PubChem CID | 90658036 |
| Molecular Formula | C10H17N2+ |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.14 |
| IUPAC Name | 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine |
| SMILES | C[NH+]1CCC[C@H]1C1C=CCN=C1 |
| InChI | InChI=1S/C10H16N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,8-10H,3,5-7H2,1H3/p+1/t9?,10-/m0/s1 |
| InChIKey | FHQCTCOXKBQXGN-AXDSSHIGSA-O |
| XLogP | -0.08 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine?
The IUPAC name of 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine (CID 90658036) is 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine.
What is the SMILES notation for 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine?
The canonical SMILES for 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine is C[NH+]1CCC[C@H]1C1C=CCN=C1.
What is the InChIKey of 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine?
The InChIKey is FHQCTCOXKBQXGN-AXDSSHIGSA-O. The full InChI is InChI=1S/C10H16N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,8-10H,3,5-7H2,1H3/p+1/t9?,10-/m0/s1.
What are the key properties of 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine?
5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine has a molecular weight of 165.26 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-1-methylpyrrolidin-1-ium-2-yl]-2,5-dihydropyridine is sourced from PubChem (CID 90658036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).