C10H15O10- — CID 90658165
(2S)-2-hydroxy-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate (PubChem CID 90658165) has the molecular formula C10H15O10- and a molecular weight of 295.22 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate.
| Compound Name | (2S)-2-hydroxy-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 90658165 |
| Molecular Formula | C10H15O10- |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (2S)-2-hydroxy-4-oxo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate |
| SMILES | O=C(C[C@H](O)C(=O)[O-])O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O10/c11-2-4-6(14)7(15)8(16)10(19-4)20-5(13)1-3(12)9(17)18/h3-4,6-8,10-12,14-16H,1-2H2,(H,17,18)/p-1/t3-,4+,6+,7-,8+,10-/m0/s1 |
| InChIKey | JNPIKEGPAFWHLI-RFSIWRIWSA-M |
| XLogP | -5.17 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |