C9H14O12P-3 — CID 90658185
(2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-2,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 90658185) has the molecular formula C9H14O12P-3 and a molecular weight of 345.17 g/mol. Its IUPAC name is (2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-2,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | (2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-2,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 90658185 |
| Molecular Formula | C9H14O12P-3 |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (2S,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-2,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | O=C([O-])[C@]1(O)C[C@H](O)[C@@H](O)[C@H]([C@H](O)[C@H](O)COP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C9H17O12P/c10-3-1-9(16,8(14)15)21-7(5(3)12)6(13)4(11)2-20-22(17,18)19/h3-7,10-13,16H,1-2H2,(H,14,15)(H2,17,18,19)/p-3/t3-,4+,5+,6+,7+,9-/m0/s1 |
| InChIKey | KIZXPTJSEKWTPW-YOQZMRDMSA-K |
| XLogP | -6.50 |
| TPSA | 222.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|