C15H15O5- — CID 90658351
(1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate (PubChem CID 90658351) has the molecular formula C15H15O5- and a molecular weight of 275.28 g/mol. Its IUPAC name is (1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate.
| Compound Name | (1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate |
|---|---|
| PubChem CID | 90658351 |
| Molecular Formula | C15H15O5- |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate |
| SMILES | CC1=C[C@@]23C(C=C(C(=O)[O-])[C@@H]2CC(=O)O[C@]32CO2)C1C |
| InChI | InChI=1S/C15H16O5/c1-7-5-14-10(8(7)2)3-9(13(17)18)11(14)4-12(16)20-15(14)6-19-15/h3,5,8,10-11H,4,6H2,1-2H3,(H,17,18)/p-1/t8?,10?,11-,14+,15+/m0/s1 |
| InChIKey | GHVCEFNVHLESTB-WHLHOXALSA-M |
| XLogP | 0.16 |
| TPSA | 78.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|