C15H16O5 — CID 90658352
(1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylic acid (PubChem CID 90658352) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylic acid.
| Compound Name | (1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylic acid |
|---|---|
| PubChem CID | 90658352 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1S,4aR,9aS)-7,8-dimethyl-3-oxospiro[4,4a,6a,7-tetrahydropentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylic acid |
| SMILES | CC1=C[C@@]23C(C=C(C(=O)O)[C@@H]2CC(=O)O[C@]32CO2)C1C |
| InChI | InChI=1S/C15H16O5/c1-7-5-14-10(8(7)2)3-9(13(17)18)11(14)4-12(16)20-15(14)6-19-15/h3,5,8,10-11H,4,6H2,1-2H3,(H,17,18)/t8?,10?,11-,14+,15+/m0/s1 |
| InChIKey | GHVCEFNVHLESTB-WHLHOXALSA-N |
| XLogP | 1.50 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|