C15H17O5- — CID 90658434
(1S,4aR,9aR)-8,8-dimethyl-3-oxospiro[4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate (PubChem CID 90658434) has the molecular formula C15H17O5- and a molecular weight of 277.30 g/mol. Its IUPAC name is (1S,4aR,9aR)-8,8-dimethyl-3-oxospiro[4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate.
| Compound Name | (1S,4aR,9aR)-8,8-dimethyl-3-oxospiro[4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate |
|---|---|
| PubChem CID | 90658434 |
| Molecular Formula | C15H17O5- |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (1S,4aR,9aR)-8,8-dimethyl-3-oxospiro[4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-1,2'-oxirane]-5-carboxylate |
| SMILES | CC1(C)CC2C=C(C(=O)[O-])[C@@H]3CC(=O)O[C@]4(CO4)[C@]23C1 |
| InChI | InChI=1S/C15H18O5/c1-13(2)5-8-3-9(12(17)18)10-4-11(16)20-15(7-19-15)14(8,10)6-13/h3,8,10H,4-7H2,1-2H3,(H,17,18)/p-1/t8?,10-,14+,15+/m0/s1 |
| InChIKey | YWHKSSBMSXJUIW-RCVHVDPASA-M |
| XLogP | 0.39 |
| TPSA | 78.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|