About (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium
(1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium (PubChem CID 90658496) has the molecular formula C6H10NO2+
and a molecular weight of 128.15 g/mol. Its IUPAC name is (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium.
Molecular Properties
| Compound Name | (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium |
| PubChem CID | 90658496 |
| Molecular Formula | C6H10NO2+ |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium |
| SMILES | [NH3+]C1(O)C=CC=CC1O |
| InChI | InChI=1S/C6H9NO2/c7-6(9)4-2-1-3-5(6)8/h1-5,8-9H,7H2/p+1 |
| InChIKey | PWWIBLJDJCLRSC-UHFFFAOYSA-O |
| XLogP | -1.60 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium?
The IUPAC name of (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium (CID 90658496) is (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium.
What is the SMILES notation for (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium?
The canonical SMILES for (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium is [NH3+]C1(O)C=CC=CC1O.
What is the InChIKey of (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium?
The InChIKey is PWWIBLJDJCLRSC-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H9NO2/c7-6(9)4-2-1-3-5(6)8/h1-5,8-9H,7H2/p+1.
What are the key properties of (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium?
(1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium has a molecular weight of 128.15 g/mol, XLogP of -1.60, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dihydroxycyclohexa-2,4-dien-1-yl)azanium is sourced from PubChem (CID 90658496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).