C33H56 — CID 90658677
(6E,11E)-10-ethenyl-2,3,6,10,13,16,20,21-octamethyl-17-methylidenedocosa-1,6,11,21-tetraene (PubChem CID 90658677) has the molecular formula C33H56 and a molecular weight of 452.81 g/mol. Its IUPAC name is (6E,11E)-10-ethenyl-2,3,6,10,13,16,20,21-octamethyl-17-methylidenedocosa-1,6,11,21-tetraene.
| Compound Name | (6E,11E)-10-ethenyl-2,3,6,10,13,16,20,21-octamethyl-17-methylidenedocosa-1,6,11,21-tetraene |
|---|---|
| PubChem CID | 90658677 |
| Molecular Formula | C33H56 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.44 |
| IUPAC Name | (6E,11E)-10-ethenyl-2,3,6,10,13,16,20,21-octamethyl-17-methylidenedocosa-1,6,11,21-tetraene |
| SMILES | C=CC(C)(/C=C/C(C)CCC(C)C(=C)CCC(C)C(=C)C)CC/C=C(\C)CCC(C)C(=C)C |
| InChI | InChI=1S/C33H56/c1-13-33(12,23-14-15-27(6)16-18-29(8)25(2)3)24-22-28(7)17-19-31(10)32(11)21-20-30(9)26(4)5/h13,15,22,24,28-31H,1-2,4,11,14,16-21,23H2,3,5-10,12H3/b24-22+,27-15+ |
| InChIKey | GUAPAZWRZCOQGT-JQUYWNEBSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|