C20H32O3 — CID 90658912
(1R,2E,7S,8R)-4-(hydroxymethyl)-1,8-dimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-2,11-diene-4,9-diol (PubChem CID 90658912) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,2E,7S,8R)-4-(hydroxymethyl)-1,8-dimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-2,11-diene-4,9-diol.
| Compound Name | (1R,2E,7S,8R)-4-(hydroxymethyl)-1,8-dimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-2,11-diene-4,9-diol |
|---|---|
| PubChem CID | 90658912 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,2E,7S,8R)-4-(hydroxymethyl)-1,8-dimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-2,11-diene-4,9-diol |
| SMILES | CC(C)C1=C2CC(O)[C@H](C)[C@@H]3CCC(O)(CO)/C3=C/[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H32O3/c1-12(2)14-5-7-19(4)10-17-15(6-8-20(17,23)11-21)13(3)18(22)9-16(14)19/h10,12-13,15,18,21-23H,5-9,11H2,1-4H3/b17-10+/t13-,15+,18?,19-,20?/m1/s1 |
| InChIKey | QKFLTDNSUPOLAW-OFCQYXFWSA-N |
| XLogP | 3.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|