C20H32O — CID 90658914
(4aR,4bS,7S,9S,10aR)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-9-ol (PubChem CID 90658914) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (4aR,4bS,7S,9S,10aR)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-9-ol.
| Compound Name | (4aR,4bS,7S,9S,10aR)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-9-ol |
|---|---|
| PubChem CID | 90658914 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (4aR,4bS,7S,9S,10aR)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-9-ol |
| SMILES | C=C[C@@]1(C)C=C2[C@@H](CC1)[C@]1(C)CCCC(C)(C)[C@H]1C[C@@H]2O |
| InChI | InChI=1S/C20H32O/c1-6-19(4)11-8-15-14(13-19)16(21)12-17-18(2,3)9-7-10-20(15,17)5/h6,13,15-17,21H,1,7-12H2,2-5H3/t15-,16+,17-,19-,20+/m1/s1 |
| InChIKey | BNRZBCUNLMPNJG-DSJDWBEOSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|