C24H34O5 — CID 90659227
(1S,2E,6S,10S,11R,13E,15S,16R,18R,20S)-6-ethyl-10,18-dihydroxy-11-methyl-5-oxatricyclo[13.7.0.016,20]docosa-2,13,21-triene-4,12-dione (PubChem CID 90659227) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (1S,2E,6S,10S,11R,13E,15S,16R,18R,20S)-6-ethyl-10,18-dihydroxy-11-methyl-5-oxatricyclo[13.7.0.016,20]docosa-2,13,21-triene-4,12-dione.
| Compound Name | (1S,2E,6S,10S,11R,13E,15S,16R,18R,20S)-6-ethyl-10,18-dihydroxy-11-methyl-5-oxatricyclo[13.7.0.016,20]docosa-2,13,21-triene-4,12-dione |
|---|---|
| PubChem CID | 90659227 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (1S,2E,6S,10S,11R,13E,15S,16R,18R,20S)-6-ethyl-10,18-dihydroxy-11-methyl-5-oxatricyclo[13.7.0.016,20]docosa-2,13,21-triene-4,12-dione |
| SMILES | CC[C@H]1CCC[C@H](O)[C@@H](C)C(=O)/C=C/[C@H]2[C@@H]3C[C@H](O)C[C@H]3C=C[C@H]2/C=C/C(=O)O1 |
| InChI | InChI=1S/C24H34O5/c1-3-19-5-4-6-22(26)15(2)23(27)11-10-20-16(9-12-24(28)29-19)7-8-17-13-18(25)14-21(17)20/h7-12,15-22,25-26H,3-6,13-14H2,1-2H3/b11-10+,12-9+/t15-,16+,17-,18-,19+,20-,21-,22+/m1/s1 |
| InChIKey | BINMOURRBYQUKD-MBPIVLONSA-N |
| XLogP | 3.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|