About 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane
2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane (PubChem CID 90659486) has the molecular formula C25H37NO6Si3
and a molecular weight of 531.83 g/mol. Its IUPAC name is 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane.
Molecular Properties
| Compound Name | 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane |
| PubChem CID | 90659486 |
| Molecular Formula | C25H37NO6Si3 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane |
| SMILES | CO[Si](C)(O[Si](OC)(O[Si](C)(OC)c1ccccc1)c1ccccc1)c1ccccc1.NCCO |
| InChI | InChI=1S/C23H30O5Si3.C2H7NO/c1-24-29(4,21-15-9-6-10-16-21)27-31(26-3,23-19-13-8-14-20-23)28-30(5,25-2)22-17-11-7-12-18-22;3-1-2-4/h6-20H,1-5H3;4H,1-3H2 |
| InChIKey | PWLYTRNYSPOQAZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane?
The IUPAC name of 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane (CID 90659486) is 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane.
What is the SMILES notation for 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane?
The canonical SMILES for 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane is CO[Si](C)(O[Si](OC)(O[Si](C)(OC)c1ccccc1)c1ccccc1)c1ccccc1.NCCO.
What is the InChIKey of 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane?
The InChIKey is PWLYTRNYSPOQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O5Si3.C2H7NO/c1-24-29(4,21-15-9-6-10-16-21)27-31(26-3,23-19-13-8-14-20-23)28-30(5,25-2)22-17-11-7-12-18-22;3-1-2-4/h6-20H,1-5H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane?
2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane has a molecular weight of 531.83 g/mol, XLogP of 1.70, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;methoxy-bis[(methoxy-methyl-phenylsilyl)oxy]-phenylsilane is sourced from PubChem (CID 90659486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).