About furan-2,5-dione;tetrakis(prop-1-ene)
furan-2,5-dione;tetrakis(prop-1-ene) (PubChem CID 90659509) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is furan-2,5-dione;tetrakis(prop-1-ene).
Molecular Properties
| Compound Name | furan-2,5-dione;tetrakis(prop-1-ene) |
| PubChem CID | 90659509 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | furan-2,5-dione;tetrakis(prop-1-ene) |
| SMILES | C=CC.C=CC.C=CC.C=CC.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.4C3H6/c5-3-1-2-4(6)7-3;4*1-3-2/h1-2H;4*3H,1H2,2H3 |
| InChIKey | DCQHEAWLRKJPGS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;tetrakis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;tetrakis(prop-1-ene)?
The IUPAC name of furan-2,5-dione;tetrakis(prop-1-ene) (CID 90659509) is furan-2,5-dione;tetrakis(prop-1-ene).
What is the SMILES notation for furan-2,5-dione;tetrakis(prop-1-ene)?
The canonical SMILES for furan-2,5-dione;tetrakis(prop-1-ene) is C=CC.C=CC.C=CC.C=CC.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;tetrakis(prop-1-ene)?
The InChIKey is DCQHEAWLRKJPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.4C3H6/c5-3-1-2-4(6)7-3;4*1-3-2/h1-2H;4*3H,1H2,2H3.
What are the key properties of furan-2,5-dione;tetrakis(prop-1-ene)?
furan-2,5-dione;tetrakis(prop-1-ene) has a molecular weight of 266.38 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;tetrakis(prop-1-ene) is sourced from PubChem (CID 90659509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).