About ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine
ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine (PubChem CID 90659521) has the molecular formula C13H20N2O3S2
and a molecular weight of 316.45 g/mol. Its IUPAC name is ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine |
| PubChem CID | 90659521 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine |
| SMILES | CCOC(=O)SC(=S)OCC.Cc1cccc(N)c1N |
| InChI | InChI=1S/C7H10N2.C6H10O3S2/c1-5-3-2-4-6(8)7(5)9;1-3-8-5(7)11-6(10)9-4-2/h2-4H,8-9H2,1H3;3-4H2,1-2H3 |
| InChIKey | CGBFYTHINUDWDN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine?
The IUPAC name of ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine (CID 90659521) is ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine.
What is the SMILES notation for ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine?
The canonical SMILES for ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine is CCOC(=O)SC(=S)OCC.Cc1cccc(N)c1N.
What is the InChIKey of ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine?
The InChIKey is CGBFYTHINUDWDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H10O3S2/c1-5-3-2-4-6(8)7(5)9;1-3-8-5(7)11-6(10)9-4-2/h2-4H,8-9H2,1H3;3-4H2,1-2H3.
What are the key properties of ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine?
ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine has a molecular weight of 316.45 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl ethoxycarbothioylsulfanylformate;3-methylbenzene-1,2-diamine is sourced from PubChem (CID 90659521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).