About butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane
butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane (PubChem CID 90659570) has the molecular formula C12H34O6Si2
and a molecular weight of 330.57 g/mol. Its IUPAC name is butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane |
| PubChem CID | 90659570 |
| Molecular Formula | C12H34O6Si2 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane |
| SMILES | CCCCO.CO[Si](C)(C)OC.CO[Si](C)(OC)OC |
| InChI | InChI=1S/C4H12O3Si.C4H12O2Si.C4H10O/c1-5-8(4,6-2)7-3;1-5-7(3,4)6-2;1-2-3-4-5/h1-4H3;1-4H3;5H,2-4H2,1H3 |
| InChIKey | AFWZUQUWOGKPMY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane?
The IUPAC name of butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane (CID 90659570) is butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane.
What is the SMILES notation for butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane?
The canonical SMILES for butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane is CCCCO.CO[Si](C)(C)OC.CO[Si](C)(OC)OC.
What is the InChIKey of butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane?
The InChIKey is AFWZUQUWOGKPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O3Si.C4H12O2Si.C4H10O/c1-5-8(4,6-2)7-3;1-5-7(3,4)6-2;1-2-3-4-5/h1-4H3;1-4H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane?
butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane has a molecular weight of 330.57 g/mol, XLogP of 2.25, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;dimethoxy(dimethyl)silane;trimethoxy(methyl)silane is sourced from PubChem (CID 90659570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).